C24H22Cl2N4O4S2 — CID 11713859
5-(3-acetamidopyrrolidine-1-carbonyl)-N-[(E)-1-[5-(3,4-dichlorophenyl)-4-hydroxythiophen-3-yl]ethylideneamino]thiophene-2-carboxamide (PubChem CID 11713859) has the molecular formula C24H22Cl2N4O4S2 and a molecular weight of 565.50 g/mol. Its IUPAC name is 5-(3-acetamidopyrrolidine-1-carbonyl)-N-[(E)-1-[5-(3,4-dichlorophenyl)-4-hydroxythiophen-3-yl]ethylideneamino]thiophene-2-carboxamide.
| Compound Name | 5-(3-acetamidopyrrolidine-1-carbonyl)-N-[(E)-1-[5-(3,4-dichlorophenyl)-4-hydroxythiophen-3-yl]ethylideneamino]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 11713859 |
| Molecular Formula | C24H22Cl2N4O4S2 |
| Molecular Weight | 565.50 g/mol |
| Exact Mass | 564.05 |
| IUPAC Name | 5-(3-acetamidopyrrolidine-1-carbonyl)-N-[(E)-1-[5-(3,4-dichlorophenyl)-4-hydroxythiophen-3-yl]ethylideneamino]thiophene-2-carboxamide |
| SMILES | CC(=O)NC1CCN(C(=O)c2ccc(C(=O)N/N=C(\C)c3csc(-c4ccc(Cl)c(Cl)c4)c3O)s2)C1 |
| InChI | InChI=1S/C24H22Cl2N4O4S2/c1-12(16-11-35-22(21(16)32)14-3-4-17(25)18(26)9-14)28-29-23(33)19-5-6-20(36-19)24(34)30-8-7-15(10-30)27-13(2)31/h3-6,9,11,15,32H,7-8,10H2,1-2H3,(H,27,31)(H,29,33)/b28-12+ |
| InChIKey | FAANFTVLFYMHPW-KVSWJAHQSA-N |
| XLogP | 4.99 |
| TPSA | 111.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.50 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|