C11H13ClN4 — CID 117139170
6-chloro-3-piperidin-2-yl-[1,2,4]triazolo[4,3-a]pyridine (PubChem CID 117139170) has the molecular formula C11H13ClN4 and a molecular weight of 236.71 g/mol. Its IUPAC name is 6-chloro-3-piperidin-2-yl-[1,2,4]triazolo[4,3-a]pyridine.
| Compound Name | 6-chloro-3-piperidin-2-yl-[1,2,4]triazolo[4,3-a]pyridine |
|---|---|
| PubChem CID | 117139170 |
| Molecular Formula | C11H13ClN4 |
| Molecular Weight | 236.71 g/mol |
| Exact Mass | 236.08 |
| IUPAC Name | 6-chloro-3-piperidin-2-yl-[1,2,4]triazolo[4,3-a]pyridine |
| SMILES | Clc1ccc2nnc(C3CCCCN3)n2c1 |
| InChI | InChI=1S/C11H13ClN4/c12-8-4-5-10-14-15-11(16(10)7-8)9-3-1-2-6-13-9/h4-5,7,9,13H,1-3,6H2 |
| InChIKey | YWYOTTDBLXQVPC-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 42.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.71 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |