C14H18N2O — CID 117139265
6-methyl-3-(oxan-2-ylmethyl)imidazo[1,5-a]pyridine (PubChem CID 117139265) has the molecular formula C14H18N2O and a molecular weight of 230.31 g/mol. Its IUPAC name is 6-methyl-3-(oxan-2-ylmethyl)imidazo[1,5-a]pyridine.
| Compound Name | 6-methyl-3-(oxan-2-ylmethyl)imidazo[1,5-a]pyridine |
|---|---|
| PubChem CID | 117139265 |
| Molecular Formula | C14H18N2O |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.14 |
| IUPAC Name | 6-methyl-3-(oxan-2-ylmethyl)imidazo[1,5-a]pyridine |
| SMILES | Cc1ccc2cnc(CC3CCCCO3)n2c1 |
| InChI | InChI=1S/C14H18N2O/c1-11-5-6-12-9-15-14(16(12)10-11)8-13-4-2-3-7-17-13/h5-6,9-10,13H,2-4,7-8H2,1H3 |
| InChIKey | UQYHXHYVLNGTBI-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 26.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |