C16H23N3O — CID 117140458
5-methoxy-3-(1-propan-2-ylpiperidin-3-yl)imidazo[1,5-a]pyridine (PubChem CID 117140458) has the molecular formula C16H23N3O and a molecular weight of 273.38 g/mol. Its IUPAC name is 5-methoxy-3-(1-propan-2-ylpiperidin-3-yl)imidazo[1,5-a]pyridine.
| Compound Name | 5-methoxy-3-(1-propan-2-ylpiperidin-3-yl)imidazo[1,5-a]pyridine |
|---|---|
| PubChem CID | 117140458 |
| Molecular Formula | C16H23N3O |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.18 |
| IUPAC Name | 5-methoxy-3-(1-propan-2-ylpiperidin-3-yl)imidazo[1,5-a]pyridine |
| SMILES | COc1cccc2cnc(C3CCCN(C(C)C)C3)n12 |
| InChI | InChI=1S/C16H23N3O/c1-12(2)18-9-5-6-13(11-18)16-17-10-14-7-4-8-15(20-3)19(14)16/h4,7-8,10,12-13H,5-6,9,11H2,1-3H3 |
| InChIKey | KBESSRPFZTYJCZ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 29.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |