C32H52O8Si — CID 11714098
3-[(1S,3R,5S,6R,8R,9S,10S,12S,15S,17R)-5-[tert-butyl(dimethyl)silyl]oxy-15-methoxy-10-methyl-9-phenylmethoxy-2,7,11,16-tetraoxatetracyclo[8.8.0.03,8.012,17]octadecan-6-yl]propan-1-ol (PubChem CID 11714098) has the molecular formula C32H52O8Si and a molecular weight of 592.85 g/mol. Its IUPAC name is 3-[(1S,3R,5S,6R,8R,9S,10S,12S,15S,17R)-5-[tert-butyl(dimethyl)silyl]oxy-15-methoxy-10-methyl-9-phenylmethoxy-2,7,11,16-tetraoxatetracyclo[8.8.0.03,8.012,17]octadecan-6-yl]propan-1-ol.
| Compound Name | 3-[(1S,3R,5S,6R,8R,9S,10S,12S,15S,17R)-5-[tert-butyl(dimethyl)silyl]oxy-15-methoxy-10-methyl-9-phenylmethoxy-2,7,11,16-tetraoxatetracyclo[8.8.0.03,8.012,17]octadecan-6-yl]propan-1-ol |
|---|---|
| PubChem CID | 11714098 |
| Molecular Formula | C32H52O8Si |
| Molecular Weight | 592.85 g/mol |
| Exact Mass | 592.34 |
| IUPAC Name | 3-[(1S,3R,5S,6R,8R,9S,10S,12S,15S,17R)-5-[tert-butyl(dimethyl)silyl]oxy-15-methoxy-10-methyl-9-phenylmethoxy-2,7,11,16-tetraoxatetracyclo[8.8.0.03,8.012,17]octadecan-6-yl]propan-1-ol |
| SMILES | CO[C@@H]1CC[C@@H]2O[C@@]3(C)[C@H](C[C@H]2O1)O[C@@H]1C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](CCCO)O[C@H]1[C@@H]3OCc1ccccc1 |
| InChI | InChI=1S/C32H52O8Si/c1-31(2,3)41(6,7)40-25-18-26-29(38-22(25)14-11-17-33)30(35-20-21-12-9-8-10-13-21)32(4)27(36-26)19-24-23(39-32)15-16-28(34-5)37-24/h8-10,12-13,22-30,33H,11,14-20H2,1-7H3/t22-,23+,24-,25+,26-,27+,28+,29-,30+,32+/m1/s1 |
| InChIKey | WNDRRFWQDNJADE-FMEPZFAVSA-N |
| XLogP | 5.36 |
| TPSA | 84.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.85 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|