About 3-(thian-4-yl)imidazo[1,5-a]pyridin-5-amine
3-(thian-4-yl)imidazo[1,5-a]pyridin-5-amine (PubChem CID 117141309) has the molecular formula C12H15N3S
and a molecular weight of 233.34 g/mol. Its IUPAC name is 3-(thian-4-yl)imidazo[1,5-a]pyridin-5-amine.
Molecular Properties
| Compound Name | 3-(thian-4-yl)imidazo[1,5-a]pyridin-5-amine |
| PubChem CID | 117141309 |
| Molecular Formula | C12H15N3S |
| Molecular Weight | 233.34 g/mol |
| Exact Mass | 233.10 |
| IUPAC Name | 3-(thian-4-yl)imidazo[1,5-a]pyridin-5-amine |
| SMILES | Nc1cccc2cnc(C3CCSCC3)n12 |
| InChI | InChI=1S/C12H15N3S/c13-11-3-1-2-10-8-14-12(15(10)11)9-4-6-16-7-5-9/h1-3,8-9H,4-7,13H2 |
| InChIKey | QHYIJBJQFFRMFI-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 43.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.34 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(thian-4-yl)imidazo[1,5-a]pyridin-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(thian-4-yl)imidazo[1,5-a]pyridin-5-amine?
The IUPAC name of 3-(thian-4-yl)imidazo[1,5-a]pyridin-5-amine (CID 117141309) is 3-(thian-4-yl)imidazo[1,5-a]pyridin-5-amine.
What is the SMILES notation for 3-(thian-4-yl)imidazo[1,5-a]pyridin-5-amine?
The canonical SMILES for 3-(thian-4-yl)imidazo[1,5-a]pyridin-5-amine is Nc1cccc2cnc(C3CCSCC3)n12.
What is the InChIKey of 3-(thian-4-yl)imidazo[1,5-a]pyridin-5-amine?
The InChIKey is QHYIJBJQFFRMFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15N3S/c13-11-3-1-2-10-8-14-12(15(10)11)9-4-6-16-7-5-9/h1-3,8-9H,4-7,13H2.
What are the key properties of 3-(thian-4-yl)imidazo[1,5-a]pyridin-5-amine?
3-(thian-4-yl)imidazo[1,5-a]pyridin-5-amine has a molecular weight of 233.34 g/mol, XLogP of 2.53, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(thian-4-yl)imidazo[1,5-a]pyridin-5-amine is sourced from PubChem (CID 117141309), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).