C10H12N4S — CID 117141546
3-(thiolan-2-yl)-[1,2,4]triazolo[4,3-a]pyridin-5-amine (PubChem CID 117141546) has the molecular formula C10H12N4S and a molecular weight of 220.30 g/mol. Its IUPAC name is 3-(thiolan-2-yl)-[1,2,4]triazolo[4,3-a]pyridin-5-amine.
| Compound Name | 3-(thiolan-2-yl)-[1,2,4]triazolo[4,3-a]pyridin-5-amine |
|---|---|
| PubChem CID | 117141546 |
| Molecular Formula | C10H12N4S |
| Molecular Weight | 220.30 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | 3-(thiolan-2-yl)-[1,2,4]triazolo[4,3-a]pyridin-5-amine |
| SMILES | Nc1cccc2nnc(C3CCCS3)n12 |
| InChI | InChI=1S/C10H12N4S/c11-8-4-1-5-9-12-13-10(14(8)9)7-3-2-6-15-7/h1,4-5,7H,2-3,6,11H2 |
| InChIKey | QDEUTJSZQNLZHN-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 56.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.30 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |