C38H60N2O5 — CID 11714280
[(6aR,10aR)-6,6,9-trimethyl-3-(2-methyl-7-morpholin-4-yl-7-oxoheptan-2-yl)-6a,7,10,10a-tetrahydrobenzo[c]chromen-1-yl] 4-[di(propan-2-yl)amino]butanoate (PubChem CID 11714280) has the molecular formula C38H60N2O5 and a molecular weight of 624.91 g/mol. Its IUPAC name is [(6aR,10aR)-6,6,9-trimethyl-3-(2-methyl-7-morpholin-4-yl-7-oxoheptan-2-yl)-6a,7,10,10a-tetrahydrobenzo[c]chromen-1-yl] 4-[di(propan-2-yl)amino]butanoate.
| Compound Name | [(6aR,10aR)-6,6,9-trimethyl-3-(2-methyl-7-morpholin-4-yl-7-oxoheptan-2-yl)-6a,7,10,10a-tetrahydrobenzo[c]chromen-1-yl] 4-[di(propan-2-yl)amino]butanoate |
|---|---|
| PubChem CID | 11714280 |
| Molecular Formula | C38H60N2O5 |
| Molecular Weight | 624.91 g/mol |
| Exact Mass | 624.45 |
| IUPAC Name | [(6aR,10aR)-6,6,9-trimethyl-3-(2-methyl-7-morpholin-4-yl-7-oxoheptan-2-yl)-6a,7,10,10a-tetrahydrobenzo[c]chromen-1-yl] 4-[di(propan-2-yl)amino]butanoate |
| SMILES | CC1=CC[C@@H]2[C@@H](C1)c1c(OC(=O)CCCN(C(C)C)C(C)C)cc(C(C)(C)CCCCC(=O)N3CCOCC3)cc1OC2(C)C |
| InChI | InChI=1S/C38H60N2O5/c1-26(2)40(27(3)4)18-12-14-35(42)44-32-24-29(37(6,7)17-11-10-13-34(41)39-19-21-43-22-20-39)25-33-36(32)30-23-28(5)15-16-31(30)38(8,9)45-33/h15,24-27,30-31H,10-14,16-23H2,1-9H3/t30-,31-/m1/s1 |
| InChIKey | OAFUHIZKKMQSAB-FIRIVFDPSA-N |
| XLogP | 7.80 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.91 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|