About methyl 3-methyl-[1,2,4]triazolo[4,3-a]pyridine-5-carboxylate
methyl 3-methyl-[1,2,4]triazolo[4,3-a]pyridine-5-carboxylate (PubChem CID 117142818) has the molecular formula C9H9N3O2
and a molecular weight of 191.19 g/mol. Its IUPAC name is methyl 3-methyl-[1,2,4]triazolo[4,3-a]pyridine-5-carboxylate.
Molecular Properties
| Compound Name | methyl 3-methyl-[1,2,4]triazolo[4,3-a]pyridine-5-carboxylate |
| PubChem CID | 117142818 |
| Molecular Formula | C9H9N3O2 |
| Molecular Weight | 191.19 g/mol |
| Exact Mass | 191.07 |
| IUPAC Name | methyl 3-methyl-[1,2,4]triazolo[4,3-a]pyridine-5-carboxylate |
| SMILES | COC(=O)c1cccc2nnc(C)n12 |
| InChI | InChI=1S/C9H9N3O2/c1-6-10-11-8-5-3-4-7(12(6)8)9(13)14-2/h3-5H,1-2H3 |
| InChIKey | ORKJIIFKCYCVQV-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.19 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 3-methyl-[1,2,4]triazolo[4,3-a]pyridine-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-methyl-[1,2,4]triazolo[4,3-a]pyridine-5-carboxylate?
The IUPAC name of methyl 3-methyl-[1,2,4]triazolo[4,3-a]pyridine-5-carboxylate (CID 117142818) is methyl 3-methyl-[1,2,4]triazolo[4,3-a]pyridine-5-carboxylate.
What is the SMILES notation for methyl 3-methyl-[1,2,4]triazolo[4,3-a]pyridine-5-carboxylate?
The canonical SMILES for methyl 3-methyl-[1,2,4]triazolo[4,3-a]pyridine-5-carboxylate is COC(=O)c1cccc2nnc(C)n12.
What is the InChIKey of methyl 3-methyl-[1,2,4]triazolo[4,3-a]pyridine-5-carboxylate?
The InChIKey is ORKJIIFKCYCVQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N3O2/c1-6-10-11-8-5-3-4-7(12(6)8)9(13)14-2/h3-5H,1-2H3.
What are the key properties of methyl 3-methyl-[1,2,4]triazolo[4,3-a]pyridine-5-carboxylate?
methyl 3-methyl-[1,2,4]triazolo[4,3-a]pyridine-5-carboxylate has a molecular weight of 191.19 g/mol, XLogP of 0.82, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-methyl-[1,2,4]triazolo[4,3-a]pyridine-5-carboxylate is sourced from PubChem (CID 117142818), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).