C35H22O2P — CID 11714292
CID 11714292 (PubChem CID 11714292) has the molecular formula C35H22O2P and a molecular weight of 505.53 g/mol.
| Compound Name | CID 11714292 |
|---|---|
| PubChem CID | 11714292 |
| Molecular Formula | C35H22O2P |
| Molecular Weight | 505.53 g/mol |
| Exact Mass | 505.14 |
| IUPAC Name | — |
| SMILES | [CH]1[CH][C](c2cccc3ccccc23)[C](p2oc3ccc4ccccc4c3c3c(ccc4ccccc43)o2)[CH]1 |
| InChI | InChI=1S/C35H22O2P/c1-4-13-26-23(9-1)12-7-16-29(26)30-17-8-18-33(30)38-36-31-21-19-24-10-2-5-14-27(24)34(31)35-28-15-6-3-11-25(28)20-22-32(35)37-38/h1-22H |
| InChIKey | UWJOVNKDJYMTIL-UHFFFAOYSA-N |
| XLogP | 10.38 |
| TPSA | 26.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.53 |
| LogP ≤ 5 | 10.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |