About 3-(3-hydroxyphenyl)-[1,2,4]triazolo[4,3-a]pyridine-7-carbaldehyde
3-(3-hydroxyphenyl)-[1,2,4]triazolo[4,3-a]pyridine-7-carbaldehyde (PubChem CID 117143683) has the molecular formula C13H9N3O2
and a molecular weight of 239.23 g/mol. Its IUPAC name is 3-(3-hydroxyphenyl)-[1,2,4]triazolo[4,3-a]pyridine-7-carbaldehyde.
Molecular Properties
| Compound Name | 3-(3-hydroxyphenyl)-[1,2,4]triazolo[4,3-a]pyridine-7-carbaldehyde |
| PubChem CID | 117143683 |
| Molecular Formula | C13H9N3O2 |
| Molecular Weight | 239.23 g/mol |
| Exact Mass | 239.07 |
| IUPAC Name | 3-(3-hydroxyphenyl)-[1,2,4]triazolo[4,3-a]pyridine-7-carbaldehyde |
| SMILES | O=Cc1ccn2c(-c3cccc(O)c3)nnc2c1 |
| InChI | InChI=1S/C13H9N3O2/c17-8-9-4-5-16-12(6-9)14-15-13(16)10-2-1-3-11(18)7-10/h1-8,18H |
| InChIKey | FZZSCPHLVWUFDH-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 67.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.23 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3-(3-hydroxyphenyl)-[1,2,4]triazolo[4,3-a]pyridine-7-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-hydroxyphenyl)-[1,2,4]triazolo[4,3-a]pyridine-7-carbaldehyde?
The IUPAC name of 3-(3-hydroxyphenyl)-[1,2,4]triazolo[4,3-a]pyridine-7-carbaldehyde (CID 117143683) is 3-(3-hydroxyphenyl)-[1,2,4]triazolo[4,3-a]pyridine-7-carbaldehyde.
What is the SMILES notation for 3-(3-hydroxyphenyl)-[1,2,4]triazolo[4,3-a]pyridine-7-carbaldehyde?
The canonical SMILES for 3-(3-hydroxyphenyl)-[1,2,4]triazolo[4,3-a]pyridine-7-carbaldehyde is O=Cc1ccn2c(-c3cccc(O)c3)nnc2c1.
What is the InChIKey of 3-(3-hydroxyphenyl)-[1,2,4]triazolo[4,3-a]pyridine-7-carbaldehyde?
The InChIKey is FZZSCPHLVWUFDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9N3O2/c17-8-9-4-5-16-12(6-9)14-15-13(16)10-2-1-3-11(18)7-10/h1-8,18H.
What are the key properties of 3-(3-hydroxyphenyl)-[1,2,4]triazolo[4,3-a]pyridine-7-carbaldehyde?
3-(3-hydroxyphenyl)-[1,2,4]triazolo[4,3-a]pyridine-7-carbaldehyde has a molecular weight of 239.23 g/mol, XLogP of 1.91, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-hydroxyphenyl)-[1,2,4]triazolo[4,3-a]pyridine-7-carbaldehyde is sourced from PubChem (CID 117143683), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).