C12H14BrN3S — CID 117144306
7-bromo-3-(thian-3-ylmethyl)-[1,2,4]triazolo[4,3-a]pyridine (PubChem CID 117144306) has the molecular formula C12H14BrN3S and a molecular weight of 312.24 g/mol. Its IUPAC name is 7-bromo-3-(thian-3-ylmethyl)-[1,2,4]triazolo[4,3-a]pyridine.
| Compound Name | 7-bromo-3-(thian-3-ylmethyl)-[1,2,4]triazolo[4,3-a]pyridine |
|---|---|
| PubChem CID | 117144306 |
| Molecular Formula | C12H14BrN3S |
| Molecular Weight | 312.24 g/mol |
| Exact Mass | 311.01 |
| IUPAC Name | 7-bromo-3-(thian-3-ylmethyl)-[1,2,4]triazolo[4,3-a]pyridine |
| SMILES | Brc1ccn2c(CC3CCCSC3)nnc2c1 |
| InChI | InChI=1S/C12H14BrN3S/c13-10-3-4-16-11(14-15-12(16)7-10)6-9-2-1-5-17-8-9/h3-4,7,9H,1-2,5-6,8H2 |
| InChIKey | GBYRUUOBYKIAMV-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.24 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |