C10H12N2 — CID 117144613
3-ethyl-7-methylimidazo[1,5-a]pyridine (PubChem CID 117144613) has the molecular formula C10H12N2 and a molecular weight of 160.22 g/mol. Its IUPAC name is 3-ethyl-7-methylimidazo[1,5-a]pyridine.
| Compound Name | 3-ethyl-7-methylimidazo[1,5-a]pyridine |
|---|---|
| PubChem CID | 117144613 |
| Molecular Formula | C10H12N2 |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.10 |
| IUPAC Name | 3-ethyl-7-methylimidazo[1,5-a]pyridine |
| SMILES | CCc1ncc2cc(C)ccn12 |
| InChI | InChI=1S/C10H12N2/c1-3-10-11-7-9-6-8(2)4-5-12(9)10/h4-7H,3H2,1-2H3 |
| InChIKey | IBQKFVFRWGBNQE-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |