C11H13N3O2 — CID 117145916
3-(3-methoxypropyl)-[1,2,4]triazolo[4,3-a]pyridine-8-carbaldehyde (PubChem CID 117145916) has the molecular formula C11H13N3O2 and a molecular weight of 219.24 g/mol. Its IUPAC name is 3-(3-methoxypropyl)-[1,2,4]triazolo[4,3-a]pyridine-8-carbaldehyde.
| Compound Name | 3-(3-methoxypropyl)-[1,2,4]triazolo[4,3-a]pyridine-8-carbaldehyde |
|---|---|
| PubChem CID | 117145916 |
| Molecular Formula | C11H13N3O2 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.10 |
| IUPAC Name | 3-(3-methoxypropyl)-[1,2,4]triazolo[4,3-a]pyridine-8-carbaldehyde |
| SMILES | COCCCc1nnc2c(C=O)cccn12 |
| InChI | InChI=1S/C11H13N3O2/c1-16-7-3-5-10-12-13-11-9(8-15)4-2-6-14(10)11/h2,4,6,8H,3,5,7H2,1H3 |
| InChIKey | OPMHWVSGSXMLLY-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|