C14H20N4 — CID 117147298
3-(2-piperidin-1-ylethyl)imidazo[1,5-a]pyridin-8-amine (PubChem CID 117147298) has the molecular formula C14H20N4 and a molecular weight of 244.34 g/mol. Its IUPAC name is 3-(2-piperidin-1-ylethyl)imidazo[1,5-a]pyridin-8-amine.
| Compound Name | 3-(2-piperidin-1-ylethyl)imidazo[1,5-a]pyridin-8-amine |
|---|---|
| PubChem CID | 117147298 |
| Molecular Formula | C14H20N4 |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.17 |
| IUPAC Name | 3-(2-piperidin-1-ylethyl)imidazo[1,5-a]pyridin-8-amine |
| SMILES | Nc1cccn2c(CCN3CCCCC3)ncc12 |
| InChI | InChI=1S/C14H20N4/c15-12-5-4-9-18-13(12)11-16-14(18)6-10-17-7-2-1-3-8-17/h4-5,9,11H,1-3,6-8,10,15H2 |
| InChIKey | WGFMWIDQPVLDNH-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 46.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |