About CID 11714742
CID 11714742 (PubChem CID 11714742) has the molecular formula C48H44N6O2S
and a molecular weight of 768.99 g/mol.
Molecular Properties
| Compound Name | CID 11714742 |
| PubChem CID | 11714742 |
| Molecular Formula | C48H44N6O2S |
| Molecular Weight | 768.99 g/mol |
| Exact Mass | 768.32 |
| IUPAC Name | — |
| SMILES | CN(C)c1ccc([C@@H]2CN(C)[C@]3(C(=O)Nc4ccccc43)[C@]23SC2=NC4=C(CN(Cc5ccccc5)C/C4=C\c4ccccc4)[C@@H](c4ccccc4)N2C3=O)cc1 |
| InChI | InChI=1S/C48H44N6O2S/c1-51(2)37-25-23-34(24-26-37)40-31-52(3)47(39-21-13-14-22-41(39)49-44(47)55)48(40)45(56)54-43(35-19-11-6-12-20-35)38-30-53(28-33-17-9-5-10-18-33)29-36(42(38)50-46(54)57-48)27-32-15-7-4-8-16-32/h4-27,40,43H,28-31H2,1-3H3,(H,49,55)/b36-27+/t40-,43+,47+,48-/m0/s1 |
| InChIKey | YGLGSQIQSJNNDE-WLWQBKABSA-N |
| XLogP | 7.91 |
| TPSA | 71.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 57 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 768.99 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|
Analyze CID 11714742 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 11714742?
The IUPAC name of CID 11714742 (CID 11714742) is not available.
What is the SMILES notation for CID 11714742?
The canonical SMILES for CID 11714742 is CN(C)c1ccc([C@@H]2CN(C)[C@]3(C(=O)Nc4ccccc43)[C@]23SC2=NC4=C(CN(Cc5ccccc5)C/C4=C\c4ccccc4)[C@@H](c4ccccc4)N2C3=O)cc1.
What is the InChIKey of CID 11714742?
The InChIKey is YGLGSQIQSJNNDE-WLWQBKABSA-N. The full InChI is InChI=1S/C48H44N6O2S/c1-51(2)37-25-23-34(24-26-37)40-31-52(3)47(39-21-13-14-22-41(39)49-44(47)55)48(40)45(56)54-43(35-19-11-6-12-20-35)38-30-53(28-33-17-9-5-10-18-33)29-36(42(38)50-46(54)57-48)27-32-15-7-4-8-16-32/h4-27,40,43H,28-31H2,1-3H3,(H,49,55)/b36-27+/t40-,43+,47+,48-/m0/s1.
What are the key properties of CID 11714742?
CID 11714742 has a molecular weight of 768.99 g/mol, XLogP of 7.91, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for CID 11714742 is sourced from PubChem (CID 11714742), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).