C47H58O6Si2 — CID 11714755
(5S,6S,9R)-6,8-bis[[tert-butyl(diphenyl)silyl]oxymethyl]-4-(methoxymethoxy)-6,9-dimethyl-1-oxaspiro[4.5]deca-3,7-dien-2-one (PubChem CID 11714755) has the molecular formula C47H58O6Si2 and a molecular weight of 775.15 g/mol. Its IUPAC name is (5S,6S,9R)-6,8-bis[[tert-butyl(diphenyl)silyl]oxymethyl]-4-(methoxymethoxy)-6,9-dimethyl-1-oxaspiro[4.5]deca-3,7-dien-2-one.
| Compound Name | (5S,6S,9R)-6,8-bis[[tert-butyl(diphenyl)silyl]oxymethyl]-4-(methoxymethoxy)-6,9-dimethyl-1-oxaspiro[4.5]deca-3,7-dien-2-one |
|---|---|
| PubChem CID | 11714755 |
| Molecular Formula | C47H58O6Si2 |
| Molecular Weight | 775.15 g/mol |
| Exact Mass | 774.38 |
| IUPAC Name | (5S,6S,9R)-6,8-bis[[tert-butyl(diphenyl)silyl]oxymethyl]-4-(methoxymethoxy)-6,9-dimethyl-1-oxaspiro[4.5]deca-3,7-dien-2-one |
| SMILES | COCOC1=CC(=O)O[C@]12C[C@@H](C)C(CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)=C[C@@]2(C)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C47H58O6Si2/c1-36-31-47(42(50-35-49-9)30-43(48)53-47)46(8,34-52-55(45(5,6)7,40-26-18-12-19-27-40)41-28-20-13-21-29-41)32-37(36)33-51-54(44(2,3)4,38-22-14-10-15-23-38)39-24-16-11-17-25-39/h10-30,32,36H,31,33-35H2,1-9H3/t36-,46+,47-/m1/s1 |
| InChIKey | DRQDGDKJOVEREW-YBTGPGHKSA-N |
| XLogP | 7.91 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 775.15 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|