C13H21N3OS — CID 117148021
[3-(thian-4-ylmethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl]methanol (PubChem CID 117148021) has the molecular formula C13H21N3OS and a molecular weight of 267.40 g/mol. Its IUPAC name is [3-(thian-4-ylmethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl]methanol.
| Compound Name | [3-(thian-4-ylmethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl]methanol |
|---|---|
| PubChem CID | 117148021 |
| Molecular Formula | C13H21N3OS |
| Molecular Weight | 267.40 g/mol |
| Exact Mass | 267.14 |
| IUPAC Name | [3-(thian-4-ylmethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl]methanol |
| SMILES | OCC1CCc2nnc(CC3CCSCC3)n2C1 |
| InChI | InChI=1S/C13H21N3OS/c17-9-11-1-2-12-14-15-13(16(12)8-11)7-10-3-5-18-6-4-10/h10-11,17H,1-9H2 |
| InChIKey | NIHQHONRYDNZSM-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.40 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |