C11H19N3O — CID 117148215
3-(3-methoxypropyl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-6-amine (PubChem CID 117148215) has the molecular formula C11H19N3O and a molecular weight of 209.29 g/mol. Its IUPAC name is 3-(3-methoxypropyl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-6-amine.
| Compound Name | 3-(3-methoxypropyl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-6-amine |
|---|---|
| PubChem CID | 117148215 |
| Molecular Formula | C11H19N3O |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.15 |
| IUPAC Name | 3-(3-methoxypropyl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-6-amine |
| SMILES | COCCCc1ncc2n1CC(N)CC2 |
| InChI | InChI=1S/C11H19N3O/c1-15-6-2-3-11-13-7-10-5-4-9(12)8-14(10)11/h7,9H,2-6,8,12H2,1H3 |
| InChIKey | RAGJFUVNIOSKQP-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|