C12H19N3S — CID 117148350
6-methyl-3-(thiolan-3-ylmethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine (PubChem CID 117148350) has the molecular formula C12H19N3S and a molecular weight of 237.37 g/mol. Its IUPAC name is 6-methyl-3-(thiolan-3-ylmethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine.
| Compound Name | 6-methyl-3-(thiolan-3-ylmethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine |
|---|---|
| PubChem CID | 117148350 |
| Molecular Formula | C12H19N3S |
| Molecular Weight | 237.37 g/mol |
| Exact Mass | 237.13 |
| IUPAC Name | 6-methyl-3-(thiolan-3-ylmethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine |
| SMILES | CC1CCc2nnc(CC3CCSC3)n2C1 |
| InChI | InChI=1S/C12H19N3S/c1-9-2-3-11-13-14-12(15(11)7-9)6-10-4-5-16-8-10/h9-10H,2-8H2,1H3 |
| InChIKey | OHFAZOHHZJYMFN-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.37 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |