C10H10ClN3OS — CID 117148794
3-(5-chlorothiophen-2-yl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-ol (PubChem CID 117148794) has the molecular formula C10H10ClN3OS and a molecular weight of 255.73 g/mol. Its IUPAC name is 3-(5-chlorothiophen-2-yl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-ol.
| Compound Name | 3-(5-chlorothiophen-2-yl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-ol |
|---|---|
| PubChem CID | 117148794 |
| Molecular Formula | C10H10ClN3OS |
| Molecular Weight | 255.73 g/mol |
| Exact Mass | 255.02 |
| IUPAC Name | 3-(5-chlorothiophen-2-yl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-ol |
| SMILES | OC1CCc2nnc(-c3ccc(Cl)s3)n2C1 |
| InChI | InChI=1S/C10H10ClN3OS/c11-8-3-2-7(16-8)10-13-12-9-4-1-6(15)5-14(9)10/h2-3,6,15H,1,4-5H2 |
| InChIKey | DBBLNHNFXMWJLM-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.73 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |