C13H16N4O — CID 117148965
4-[(6-amino-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)methyl]phenol (PubChem CID 117148965) has the molecular formula C13H16N4O and a molecular weight of 244.30 g/mol. Its IUPAC name is 4-[(6-amino-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)methyl]phenol.
| Compound Name | 4-[(6-amino-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)methyl]phenol |
|---|---|
| PubChem CID | 117148965 |
| Molecular Formula | C13H16N4O |
| Molecular Weight | 244.30 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | 4-[(6-amino-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)methyl]phenol |
| SMILES | NC1CCc2nnc(Cc3ccc(O)cc3)n2C1 |
| InChI | InChI=1S/C13H16N4O/c14-10-3-6-12-15-16-13(17(12)8-10)7-9-1-4-11(18)5-2-9/h1-2,4-5,10,18H,3,6-8,14H2 |
| InChIKey | RCUVCKOZOXZUBG-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 76.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.30 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |