C11H18N4O — CID 117150062
3-(oxolan-2-ylmethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-5-amine (PubChem CID 117150062) has the molecular formula C11H18N4O and a molecular weight of 222.29 g/mol. Its IUPAC name is 3-(oxolan-2-ylmethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-5-amine.
| Compound Name | 3-(oxolan-2-ylmethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-5-amine |
|---|---|
| PubChem CID | 117150062 |
| Molecular Formula | C11H18N4O |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.15 |
| IUPAC Name | 3-(oxolan-2-ylmethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-5-amine |
| SMILES | NC1CCCc2nnc(CC3CCCO3)n21 |
| InChI | InChI=1S/C11H18N4O/c12-9-4-1-5-10-13-14-11(15(9)10)7-8-3-2-6-16-8/h8-9H,1-7,12H2 |
| InChIKey | QWCWDNCSRQYFIX-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |