About 2-cyclopropylacetamide
2-cyclopropylacetamide (PubChem CID 11715166) has the molecular formula C5H9NO
and a molecular weight of 99.13 g/mol. Its IUPAC name is 2-cyclopropylacetamide.
Molecular Properties
| Compound Name | 2-cyclopropylacetamide |
| PubChem CID | 11715166 |
| Molecular Formula | C5H9NO |
| Molecular Weight | 99.13 g/mol |
| Exact Mass | 99.07 |
| IUPAC Name | 2-cyclopropylacetamide |
| SMILES | NC(=O)CC1CC1 |
| InChI | InChI=1S/C5H9NO/c6-5(7)3-4-1-2-4/h4H,1-3H2,(H2,6,7) |
| InChIKey | JBSLANHIBKBQGE-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 99.13 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-cyclopropylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopropylacetamide?
The IUPAC name of 2-cyclopropylacetamide (CID 11715166) is 2-cyclopropylacetamide.
What is the SMILES notation for 2-cyclopropylacetamide?
The canonical SMILES for 2-cyclopropylacetamide is NC(=O)CC1CC1.
What is the InChIKey of 2-cyclopropylacetamide?
The InChIKey is JBSLANHIBKBQGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9NO/c6-5(7)3-4-1-2-4/h4H,1-3H2,(H2,6,7).
What are the key properties of 2-cyclopropylacetamide?
2-cyclopropylacetamide has a molecular weight of 99.13 g/mol, XLogP of 0.27, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopropylacetamide is sourced from PubChem (CID 11715166), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).