C7H8O2 — CID 11715173
(1S,2S,4S,7S)-1-methyl-3,8-dioxatricyclo[5.1.0.02,4]oct-5-ene (PubChem CID 11715173) has the molecular formula C7H8O2 and a molecular weight of 124.14 g/mol. Its IUPAC name is (1S,2S,4S,7S)-1-methyl-3,8-dioxatricyclo[5.1.0.02,4]oct-5-ene.
| Compound Name | (1S,2S,4S,7S)-1-methyl-3,8-dioxatricyclo[5.1.0.02,4]oct-5-ene |
|---|---|
| PubChem CID | 11715173 |
| Molecular Formula | C7H8O2 |
| Molecular Weight | 124.14 g/mol |
| Exact Mass | 124.05 |
| IUPAC Name | (1S,2S,4S,7S)-1-methyl-3,8-dioxatricyclo[5.1.0.02,4]oct-5-ene |
| SMILES | C[C@]12O[C@H]1C=C[C@@H]1O[C@@H]12 |
| InChI | InChI=1S/C7H8O2/c1-7-5(9-7)3-2-4-6(7)8-4/h2-6H,1H3/t4-,5-,6-,7-/m0/s1 |
| InChIKey | IKUZFWBIVSKYQU-AXMZGBSTSA-N |
| XLogP | 0.48 |
| TPSA | 25.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 124.14 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|