About N-propan-2-yl-4,5-dihydro-1H-imidazol-2-amine
N-propan-2-yl-4,5-dihydro-1H-imidazol-2-amine (PubChem CID 11715178) has the molecular formula C6H13N3
and a molecular weight of 127.19 g/mol. Its IUPAC name is N-propan-2-yl-4,5-dihydro-1H-imidazol-2-amine.
Molecular Properties
| Compound Name | N-propan-2-yl-4,5-dihydro-1H-imidazol-2-amine |
| PubChem CID | 11715178 |
| Molecular Formula | C6H13N3 |
| Molecular Weight | 127.19 g/mol |
| Exact Mass | 127.11 |
| IUPAC Name | N-propan-2-yl-4,5-dihydro-1H-imidazol-2-amine |
| SMILES | CC(C)NC1=NCCN1 |
| InChI | InChI=1S/C6H13N3/c1-5(2)9-6-7-3-4-8-6/h5H,3-4H2,1-2H3,(H2,7,8,9) |
| InChIKey | MEWFQWCZHSJROJ-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.19 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-propan-2-yl-4,5-dihydro-1H-imidazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-propan-2-yl-4,5-dihydro-1H-imidazol-2-amine?
The IUPAC name of N-propan-2-yl-4,5-dihydro-1H-imidazol-2-amine (CID 11715178) is N-propan-2-yl-4,5-dihydro-1H-imidazol-2-amine.
What is the SMILES notation for N-propan-2-yl-4,5-dihydro-1H-imidazol-2-amine?
The canonical SMILES for N-propan-2-yl-4,5-dihydro-1H-imidazol-2-amine is CC(C)NC1=NCCN1.
What is the InChIKey of N-propan-2-yl-4,5-dihydro-1H-imidazol-2-amine?
The InChIKey is MEWFQWCZHSJROJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13N3/c1-5(2)9-6-7-3-4-8-6/h5H,3-4H2,1-2H3,(H2,7,8,9).
What are the key properties of N-propan-2-yl-4,5-dihydro-1H-imidazol-2-amine?
N-propan-2-yl-4,5-dihydro-1H-imidazol-2-amine has a molecular weight of 127.19 g/mol, XLogP of -0.06, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-propan-2-yl-4,5-dihydro-1H-imidazol-2-amine is sourced from PubChem (CID 11715178), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).