C11H15N3O3 — CID 117151935
3-(oxolan-2-yl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine-8-carboxylic acid (PubChem CID 117151935) has the molecular formula C11H15N3O3 and a molecular weight of 237.26 g/mol. Its IUPAC name is 3-(oxolan-2-yl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine-8-carboxylic acid.
| Compound Name | 3-(oxolan-2-yl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine-8-carboxylic acid |
|---|---|
| PubChem CID | 117151935 |
| Molecular Formula | C11H15N3O3 |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.11 |
| IUPAC Name | 3-(oxolan-2-yl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine-8-carboxylic acid |
| SMILES | O=C(O)C1CCCn2c(C3CCCO3)nnc21 |
| InChI | InChI=1S/C11H15N3O3/c15-11(16)7-3-1-5-14-9(7)12-13-10(14)8-4-2-6-17-8/h7-8H,1-6H2,(H,15,16) |
| InChIKey | GMIFLPPPMBNKET-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |