C10H16N4O2S — CID 117152623
3-(1,1-dioxothiolan-2-yl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-8-amine (PubChem CID 117152623) has the molecular formula C10H16N4O2S and a molecular weight of 256.33 g/mol. Its IUPAC name is 3-(1,1-dioxothiolan-2-yl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-8-amine.
| Compound Name | 3-(1,1-dioxothiolan-2-yl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-8-amine |
|---|---|
| PubChem CID | 117152623 |
| Molecular Formula | C10H16N4O2S |
| Molecular Weight | 256.33 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | 3-(1,1-dioxothiolan-2-yl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-8-amine |
| SMILES | NC1CCCn2c1nnc2C1CCCS1(=O)=O |
| InChI | InChI=1S/C10H16N4O2S/c11-7-3-1-5-14-9(7)12-13-10(14)8-4-2-6-17(8,15)16/h7-8H,1-6,11H2 |
| InChIKey | WNXGBZFFCNMGIU-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.33 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |