About 6-methyl-3-phenyl-1,4-dihydropyrimidin-2-one
6-methyl-3-phenyl-1,4-dihydropyrimidin-2-one (PubChem CID 11715311) has the molecular formula C11H12N2O
and a molecular weight of 188.23 g/mol. Its IUPAC name is 6-methyl-3-phenyl-1,4-dihydropyrimidin-2-one.
Molecular Properties
| Compound Name | 6-methyl-3-phenyl-1,4-dihydropyrimidin-2-one |
| PubChem CID | 11715311 |
| Molecular Formula | C11H12N2O |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.09 |
| IUPAC Name | 6-methyl-3-phenyl-1,4-dihydropyrimidin-2-one |
| SMILES | CC1=CCN(c2ccccc2)C(=O)N1 |
| InChI | InChI=1S/C11H12N2O/c1-9-7-8-13(11(14)12-9)10-5-3-2-4-6-10/h2-7H,8H2,1H3,(H,12,14) |
| InChIKey | YZZLIWHPBLIBDZ-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-methyl-3-phenyl-1,4-dihydropyrimidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-3-phenyl-1,4-dihydropyrimidin-2-one?
The IUPAC name of 6-methyl-3-phenyl-1,4-dihydropyrimidin-2-one (CID 11715311) is 6-methyl-3-phenyl-1,4-dihydropyrimidin-2-one.
What is the SMILES notation for 6-methyl-3-phenyl-1,4-dihydropyrimidin-2-one?
The canonical SMILES for 6-methyl-3-phenyl-1,4-dihydropyrimidin-2-one is CC1=CCN(c2ccccc2)C(=O)N1.
What is the InChIKey of 6-methyl-3-phenyl-1,4-dihydropyrimidin-2-one?
The InChIKey is YZZLIWHPBLIBDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N2O/c1-9-7-8-13(11(14)12-9)10-5-3-2-4-6-10/h2-7H,8H2,1H3,(H,12,14).
What are the key properties of 6-methyl-3-phenyl-1,4-dihydropyrimidin-2-one?
6-methyl-3-phenyl-1,4-dihydropyrimidin-2-one has a molecular weight of 188.23 g/mol, XLogP of 2.12, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-3-phenyl-1,4-dihydropyrimidin-2-one is sourced from PubChem (CID 11715311), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).