C11H15N3O4S — CID 117153310
2-(1,1-dioxothiolan-2-yl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine-6-carboxylic acid (PubChem CID 117153310) has the molecular formula C11H15N3O4S and a molecular weight of 285.33 g/mol. Its IUPAC name is 2-(1,1-dioxothiolan-2-yl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine-6-carboxylic acid.
| Compound Name | 2-(1,1-dioxothiolan-2-yl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine-6-carboxylic acid |
|---|---|
| PubChem CID | 117153310 |
| Molecular Formula | C11H15N3O4S |
| Molecular Weight | 285.33 g/mol |
| Exact Mass | 285.08 |
| IUPAC Name | 2-(1,1-dioxothiolan-2-yl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine-6-carboxylic acid |
| SMILES | O=C(O)C1CCc2nc(C3CCCS3(=O)=O)nn2C1 |
| InChI | InChI=1S/C11H15N3O4S/c15-11(16)7-3-4-9-12-10(13-14(9)6-7)8-2-1-5-19(8,17)18/h7-8H,1-6H2,(H,15,16) |
| InChIKey | PVLZWOBQQXEYOD-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 102.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.33 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |