C14H16ClN3O — CID 117153630
[2-[(4-chlorophenyl)methyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]methanol (PubChem CID 117153630) has the molecular formula C14H16ClN3O and a molecular weight of 277.75 g/mol. Its IUPAC name is [2-[(4-chlorophenyl)methyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]methanol.
| Compound Name | [2-[(4-chlorophenyl)methyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]methanol |
|---|---|
| PubChem CID | 117153630 |
| Molecular Formula | C14H16ClN3O |
| Molecular Weight | 277.75 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | [2-[(4-chlorophenyl)methyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]methanol |
| SMILES | OCC1CCc2nc(Cc3ccc(Cl)cc3)nn2C1 |
| InChI | InChI=1S/C14H16ClN3O/c15-12-4-1-10(2-5-12)7-13-16-14-6-3-11(9-19)8-18(14)17-13/h1-2,4-5,11,19H,3,6-9H2 |
| InChIKey | MMHCJTPRHJSLDL-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.75 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |