C11H12N2O — CID 117154287
2-(furan-2-yl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine (PubChem CID 117154287) has the molecular formula C11H12N2O and a molecular weight of 188.23 g/mol. Its IUPAC name is 2-(furan-2-yl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine.
| Compound Name | 2-(furan-2-yl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 117154287 |
| Molecular Formula | C11H12N2O |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.09 |
| IUPAC Name | 2-(furan-2-yl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine |
| SMILES | c1coc(-c2cn3c(n2)CCCC3)c1 |
| InChI | InChI=1S/C11H12N2O/c1-2-6-13-8-9(12-11(13)5-1)10-4-3-7-14-10/h3-4,7-8H,1-2,5-6H2 |
| InChIKey | OTOCNOXCCWXEQN-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 30.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |