About ethyl 4-hydroxy-3,3-dimethylbicyclo[3.2.0]hepta-1,5-diene-6-carboxylate
ethyl 4-hydroxy-3,3-dimethylbicyclo[3.2.0]hepta-1,5-diene-6-carboxylate (PubChem CID 11715430) has the molecular formula C12H16O3
and a molecular weight of 208.26 g/mol. Its IUPAC name is ethyl 4-hydroxy-3,3-dimethylbicyclo[3.2.0]hepta-1,5-diene-6-carboxylate.
Molecular Properties
| Compound Name | ethyl 4-hydroxy-3,3-dimethylbicyclo[3.2.0]hepta-1,5-diene-6-carboxylate |
| PubChem CID | 11715430 |
| Molecular Formula | C12H16O3 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.11 |
| IUPAC Name | ethyl 4-hydroxy-3,3-dimethylbicyclo[3.2.0]hepta-1,5-diene-6-carboxylate |
| SMILES | CCOC(=O)C1=C2C(=CC(C)(C)C2O)C1 |
| InChI | InChI=1S/C12H16O3/c1-4-15-11(14)8-5-7-6-12(2,3)10(13)9(7)8/h6,10,13H,4-5H2,1-3H3 |
| InChIKey | HEJDKTOFQOJRSI-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl 4-hydroxy-3,3-dimethylbicyclo[3.2.0]hepta-1,5-diene-6-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-hydroxy-3,3-dimethylbicyclo[3.2.0]hepta-1,5-diene-6-carboxylate?
The IUPAC name of ethyl 4-hydroxy-3,3-dimethylbicyclo[3.2.0]hepta-1,5-diene-6-carboxylate (CID 11715430) is ethyl 4-hydroxy-3,3-dimethylbicyclo[3.2.0]hepta-1,5-diene-6-carboxylate.
What is the SMILES notation for ethyl 4-hydroxy-3,3-dimethylbicyclo[3.2.0]hepta-1,5-diene-6-carboxylate?
The canonical SMILES for ethyl 4-hydroxy-3,3-dimethylbicyclo[3.2.0]hepta-1,5-diene-6-carboxylate is CCOC(=O)C1=C2C(=CC(C)(C)C2O)C1.
What is the InChIKey of ethyl 4-hydroxy-3,3-dimethylbicyclo[3.2.0]hepta-1,5-diene-6-carboxylate?
The InChIKey is HEJDKTOFQOJRSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16O3/c1-4-15-11(14)8-5-7-6-12(2,3)10(13)9(7)8/h6,10,13H,4-5H2,1-3H3.
What are the key properties of ethyl 4-hydroxy-3,3-dimethylbicyclo[3.2.0]hepta-1,5-diene-6-carboxylate?
ethyl 4-hydroxy-3,3-dimethylbicyclo[3.2.0]hepta-1,5-diene-6-carboxylate has a molecular weight of 208.26 g/mol, XLogP of 1.58, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-hydroxy-3,3-dimethylbicyclo[3.2.0]hepta-1,5-diene-6-carboxylate is sourced from PubChem (CID 11715430), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).