C10H19N3O2 — CID 11715469
ethyl 2-[(8aS)-2,3,5,6,8,8a-hexahydro-1H-imidazo[1,5-a]pyrazin-7-yl]acetate (PubChem CID 11715469) has the molecular formula C10H19N3O2 and a molecular weight of 213.28 g/mol. Its IUPAC name is ethyl 2-[(8aS)-2,3,5,6,8,8a-hexahydro-1H-imidazo[1,5-a]pyrazin-7-yl]acetate.
| Compound Name | ethyl 2-[(8aS)-2,3,5,6,8,8a-hexahydro-1H-imidazo[1,5-a]pyrazin-7-yl]acetate |
|---|---|
| PubChem CID | 11715469 |
| Molecular Formula | C10H19N3O2 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.15 |
| IUPAC Name | ethyl 2-[(8aS)-2,3,5,6,8,8a-hexahydro-1H-imidazo[1,5-a]pyrazin-7-yl]acetate |
| SMILES | CCOC(=O)CN1CCN2CNC[C@H]2C1 |
| InChI | InChI=1S/C10H19N3O2/c1-2-15-10(14)7-12-3-4-13-8-11-5-9(13)6-12/h9,11H,2-8H2,1H3/t9-/m0/s1 |
| InChIKey | UHDSRYQIMYTOOE-VIFPVBQESA-N |
| XLogP | -0.90 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |