About 5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-5-ylmethanol
5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-5-ylmethanol (PubChem CID 117155074) has the molecular formula C8H12N2O
and a molecular weight of 152.20 g/mol. Its IUPAC name is 5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-5-ylmethanol.
Analyze 5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-5-ylmethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-5-ylmethanol?
The IUPAC name of 5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-5-ylmethanol (CID 117155074) is 5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-5-ylmethanol.
What is the SMILES notation for 5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-5-ylmethanol?
The canonical SMILES for 5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-5-ylmethanol is OCC1CCCc2nccn21.
What is the InChIKey of 5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-5-ylmethanol?
The InChIKey is KEVRKBAIWACKMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O/c11-6-7-2-1-3-8-9-4-5-10(7)8/h4-5,7,11H,1-3,6H2.
What are the key properties of 5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-5-ylmethanol?
5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-5-ylmethanol has a molecular weight of 152.20 g/mol, XLogP of 0.75, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-5-ylmethanol is sourced from PubChem (CID 117155074), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).