C12H20N4S — CID 117155313
2-(thian-4-ylmethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-5-amine (PubChem CID 117155313) has the molecular formula C12H20N4S and a molecular weight of 252.39 g/mol. Its IUPAC name is 2-(thian-4-ylmethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-5-amine.
| Compound Name | 2-(thian-4-ylmethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-5-amine |
|---|---|
| PubChem CID | 117155313 |
| Molecular Formula | C12H20N4S |
| Molecular Weight | 252.39 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | 2-(thian-4-ylmethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-5-amine |
| SMILES | NC1CCCc2nc(CC3CCSCC3)nn21 |
| InChI | InChI=1S/C12H20N4S/c13-10-2-1-3-12-14-11(15-16(10)12)8-9-4-6-17-7-5-9/h9-10H,1-8,13H2 |
| InChIKey | BZWDIUVUQSIDTN-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.39 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |