C13H22O3 — CID 11715572
(3R,4S,5S,6E,10E)-5-methoxy-3-methyl-1-oxacyclododeca-6,10-dien-4-ol (PubChem CID 11715572) has the molecular formula C13H22O3 and a molecular weight of 226.32 g/mol. Its IUPAC name is (3R,4S,5S,6E,10E)-5-methoxy-3-methyl-1-oxacyclododeca-6,10-dien-4-ol.
| Compound Name | (3R,4S,5S,6E,10E)-5-methoxy-3-methyl-1-oxacyclododeca-6,10-dien-4-ol |
|---|---|
| PubChem CID | 11715572 |
| Molecular Formula | C13H22O3 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.16 |
| IUPAC Name | (3R,4S,5S,6E,10E)-5-methoxy-3-methyl-1-oxacyclododeca-6,10-dien-4-ol |
| SMILES | CO[C@H]1/C=C/CC/C=C/COC[C@@H](C)[C@@H]1O |
| InChI | InChI=1S/C13H22O3/c1-11-10-16-9-7-5-3-4-6-8-12(15-2)13(11)14/h5-8,11-14H,3-4,9-10H2,1-2H3/b7-5+,8-6+/t11-,12+,13+/m1/s1 |
| InChIKey | SQCSQOSVEAVFRP-CJWPQMDPSA-N |
| XLogP | 1.92 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|