About 2-ethyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-5-ol
2-ethyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-5-ol (PubChem CID 117155779) has the molecular formula C9H14N2O
and a molecular weight of 166.22 g/mol. Its IUPAC name is 2-ethyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-5-ol.
Analyze 2-ethyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-5-ol?
The IUPAC name of 2-ethyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-5-ol (CID 117155779) is 2-ethyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-5-ol.
What is the SMILES notation for 2-ethyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-5-ol?
The canonical SMILES for 2-ethyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-5-ol is CCc1cn2c(n1)CCCC2O.
What is the InChIKey of 2-ethyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-5-ol?
The InChIKey is QKZREUSRNMHSLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2O/c1-2-7-6-11-8(10-7)4-3-5-9(11)12/h6,9,12H,2-5H2,1H3.
What are the key properties of 2-ethyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-5-ol?
2-ethyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-5-ol has a molecular weight of 166.22 g/mol, XLogP of 1.27, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-5-ol is sourced from PubChem (CID 117155779), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).