C11H19N3O2 — CID 117156094
[2-(3-methoxypropyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-7-yl]methanol (PubChem CID 117156094) has the molecular formula C11H19N3O2 and a molecular weight of 225.29 g/mol. Its IUPAC name is [2-(3-methoxypropyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-7-yl]methanol.
| Compound Name | [2-(3-methoxypropyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-7-yl]methanol |
|---|---|
| PubChem CID | 117156094 |
| Molecular Formula | C11H19N3O2 |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.15 |
| IUPAC Name | [2-(3-methoxypropyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-7-yl]methanol |
| SMILES | COCCCc1nc2n(n1)CCC(CO)C2 |
| InChI | InChI=1S/C11H19N3O2/c1-16-6-2-3-10-12-11-7-9(8-15)4-5-14(11)13-10/h9,15H,2-8H2,1H3 |
| InChIKey | GEWBFXWAUWGHIO-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|