C11H18N2O2 — CID 117156384
2-(3-methoxypropyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-7-ol (PubChem CID 117156384) has the molecular formula C11H18N2O2 and a molecular weight of 210.28 g/mol. Its IUPAC name is 2-(3-methoxypropyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-7-ol.
| Compound Name | 2-(3-methoxypropyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-7-ol |
|---|---|
| PubChem CID | 117156384 |
| Molecular Formula | C11H18N2O2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | 2-(3-methoxypropyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-7-ol |
| SMILES | COCCCc1cn2c(n1)CC(O)CC2 |
| InChI | InChI=1S/C11H18N2O2/c1-15-6-2-3-9-8-13-5-4-10(14)7-11(13)12-9/h8,10,14H,2-7H2,1H3 |
| InChIKey | XEVGNQDYGIAEEO-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|