C11H20N4 — CID 117157081
N,N-dimethyl-2-(7-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-yl)ethanamine (PubChem CID 117157081) has the molecular formula C11H20N4 and a molecular weight of 208.31 g/mol. Its IUPAC name is N,N-dimethyl-2-(7-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-yl)ethanamine.
| Compound Name | N,N-dimethyl-2-(7-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-yl)ethanamine |
|---|---|
| PubChem CID | 117157081 |
| Molecular Formula | C11H20N4 |
| Molecular Weight | 208.31 g/mol |
| Exact Mass | 208.17 |
| IUPAC Name | N,N-dimethyl-2-(7-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-yl)ethanamine |
| SMILES | CC1CCn2nc(CCN(C)C)nc2C1 |
| InChI | InChI=1S/C11H20N4/c1-9-4-7-15-11(8-9)12-10(13-15)5-6-14(2)3/h9H,4-8H2,1-3H3 |
| InChIKey | JTGWAUGKSDADON-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.31 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |