C16H28N4O — CID 117157446
[2-[(1-propan-2-ylpiperidin-3-yl)methyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl]methanol (PubChem CID 117157446) has the molecular formula C16H28N4O and a molecular weight of 292.43 g/mol. Its IUPAC name is [2-[(1-propan-2-ylpiperidin-3-yl)methyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl]methanol.
| Compound Name | [2-[(1-propan-2-ylpiperidin-3-yl)methyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl]methanol |
|---|---|
| PubChem CID | 117157446 |
| Molecular Formula | C16H28N4O |
| Molecular Weight | 292.43 g/mol |
| Exact Mass | 292.23 |
| IUPAC Name | [2-[(1-propan-2-ylpiperidin-3-yl)methyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl]methanol |
| SMILES | CC(C)N1CCCC(Cc2nc3n(n2)CCCC3CO)C1 |
| InChI | InChI=1S/C16H28N4O/c1-12(2)19-7-3-5-13(10-19)9-15-17-16-14(11-21)6-4-8-20(16)18-15/h12-14,21H,3-11H2,1-2H3 |
| InChIKey | SVWHTXPUDVLRNO-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.43 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |