C13H19BO4 — CID 11715768
3-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol (PubChem CID 11715768) has the molecular formula C13H19BO4 and a molecular weight of 250.10 g/mol. Its IUPAC name is 3-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol.
| Compound Name | 3-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol |
|---|---|
| PubChem CID | 11715768 |
| Molecular Formula | C13H19BO4 |
| Molecular Weight | 250.10 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | 3-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol |
| SMILES | COc1cc(O)cc(B2OC(C)(C)C(C)(C)O2)c1 |
| InChI | InChI=1S/C13H19BO4/c1-12(2)13(3,4)18-14(17-12)9-6-10(15)8-11(7-9)16-5/h6-8,15H,1-5H3 |
| InChIKey | CCAYVXOPUWTCNL-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.10 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|