C15H22O3 — CID 11715775
5,7-diethyl-2,2-dimethyl-3,4-dihydrochromene-4,6-diol (PubChem CID 11715775) has the molecular formula C15H22O3 and a molecular weight of 250.34 g/mol. Its IUPAC name is 5,7-diethyl-2,2-dimethyl-3,4-dihydrochromene-4,6-diol.
| Compound Name | 5,7-diethyl-2,2-dimethyl-3,4-dihydrochromene-4,6-diol |
|---|---|
| PubChem CID | 11715775 |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | 5,7-diethyl-2,2-dimethyl-3,4-dihydrochromene-4,6-diol |
| SMILES | CCc1cc2c(c(CC)c1O)C(O)CC(C)(C)O2 |
| InChI | InChI=1S/C15H22O3/c1-5-9-7-12-13(10(6-2)14(9)17)11(16)8-15(3,4)18-12/h7,11,16-17H,5-6,8H2,1-4H3 |
| InChIKey | AXZQFLKXPGVDHF-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |