C14H26N2O2 — CID 11715814
(Z,4S)-4-(2,2-dimethylpropanoylamino)-2-methyl-N-propan-2-ylpent-2-enamide (PubChem CID 11715814) has the molecular formula C14H26N2O2 and a molecular weight of 254.37 g/mol. Its IUPAC name is (Z,4S)-4-(2,2-dimethylpropanoylamino)-2-methyl-N-propan-2-ylpent-2-enamide.
| Compound Name | (Z,4S)-4-(2,2-dimethylpropanoylamino)-2-methyl-N-propan-2-ylpent-2-enamide |
|---|---|
| PubChem CID | 11715814 |
| Molecular Formula | C14H26N2O2 |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.20 |
| IUPAC Name | (Z,4S)-4-(2,2-dimethylpropanoylamino)-2-methyl-N-propan-2-ylpent-2-enamide |
| SMILES | C/C(=C/[C@H](C)NC(=O)C(C)(C)C)C(=O)NC(C)C |
| InChI | InChI=1S/C14H26N2O2/c1-9(2)15-12(17)10(3)8-11(4)16-13(18)14(5,6)7/h8-9,11H,1-7H3,(H,15,17)(H,16,18)/b10-8-/t11-/m0/s1 |
| InChIKey | HQWYSBKYPUIHEH-IEHMKBBKSA-N |
| XLogP | 2.01 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|