About 3-(6-bromoimidazo[1,5-a]pyridin-3-yl)aniline
3-(6-bromoimidazo[1,5-a]pyridin-3-yl)aniline (PubChem CID 117158425) has the molecular formula C13H10BrN3
and a molecular weight of 288.15 g/mol. Its IUPAC name is 3-(6-bromoimidazo[1,5-a]pyridin-3-yl)aniline.
Molecular Properties
| Compound Name | 3-(6-bromoimidazo[1,5-a]pyridin-3-yl)aniline |
| PubChem CID | 117158425 |
| Molecular Formula | C13H10BrN3 |
| Molecular Weight | 288.15 g/mol |
| Exact Mass | 287.01 |
| IUPAC Name | 3-(6-bromoimidazo[1,5-a]pyridin-3-yl)aniline |
| SMILES | Nc1cccc(-c2ncc3ccc(Br)cn23)c1 |
| InChI | InChI=1S/C13H10BrN3/c14-10-4-5-12-7-16-13(17(12)8-10)9-2-1-3-11(15)6-9/h1-8H,15H2 |
| InChIKey | BUPAQFBNJDCQQZ-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 43.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.15 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-(6-bromoimidazo[1,5-a]pyridin-3-yl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(6-bromoimidazo[1,5-a]pyridin-3-yl)aniline?
The IUPAC name of 3-(6-bromoimidazo[1,5-a]pyridin-3-yl)aniline (CID 117158425) is 3-(6-bromoimidazo[1,5-a]pyridin-3-yl)aniline.
What is the SMILES notation for 3-(6-bromoimidazo[1,5-a]pyridin-3-yl)aniline?
The canonical SMILES for 3-(6-bromoimidazo[1,5-a]pyridin-3-yl)aniline is Nc1cccc(-c2ncc3ccc(Br)cn23)c1.
What is the InChIKey of 3-(6-bromoimidazo[1,5-a]pyridin-3-yl)aniline?
The InChIKey is BUPAQFBNJDCQQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10BrN3/c14-10-4-5-12-7-16-13(17(12)8-10)9-2-1-3-11(15)6-9/h1-8H,15H2.
What are the key properties of 3-(6-bromoimidazo[1,5-a]pyridin-3-yl)aniline?
3-(6-bromoimidazo[1,5-a]pyridin-3-yl)aniline has a molecular weight of 288.15 g/mol, XLogP of 3.35, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(6-bromoimidazo[1,5-a]pyridin-3-yl)aniline is sourced from PubChem (CID 117158425), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).