C13H14ClNO4 — CID 11716141
3-[(1R)-1-(4-chlorophenyl)-2-nitroethyl]pentane-2,4-dione (PubChem CID 11716141) has the molecular formula C13H14ClNO4 and a molecular weight of 283.71 g/mol. Its IUPAC name is 3-[(1R)-1-(4-chlorophenyl)-2-nitroethyl]pentane-2,4-dione.
| Compound Name | 3-[(1R)-1-(4-chlorophenyl)-2-nitroethyl]pentane-2,4-dione |
|---|---|
| PubChem CID | 11716141 |
| Molecular Formula | C13H14ClNO4 |
| Molecular Weight | 283.71 g/mol |
| Exact Mass | 283.06 |
| IUPAC Name | 3-[(1R)-1-(4-chlorophenyl)-2-nitroethyl]pentane-2,4-dione |
| SMILES | CC(=O)C(C(C)=O)[C@@H](C[N+](=O)[O-])c1ccc(Cl)cc1 |
| InChI | InChI=1S/C13H14ClNO4/c1-8(16)13(9(2)17)12(7-15(18)19)10-3-5-11(14)6-4-10/h3-6,12-13H,7H2,1-2H3/t12-/m0/s1 |
| InChIKey | FRMOCFVURYNUEI-LBPRGKRZSA-N |
| XLogP | 2.49 |
| TPSA | 77.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.71 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|