C13H15ClN2O — CID 11716185
(3aR,9bS)-6-chloro-8-ethyl-1,2,3,3a,4,9b-hexahydropyrrolo[3,4-c]isoquinolin-5-one (PubChem CID 11716185) has the molecular formula C13H15ClN2O and a molecular weight of 250.73 g/mol. Its IUPAC name is (3aR,9bS)-6-chloro-8-ethyl-1,2,3,3a,4,9b-hexahydropyrrolo[3,4-c]isoquinolin-5-one.
| Compound Name | (3aR,9bS)-6-chloro-8-ethyl-1,2,3,3a,4,9b-hexahydropyrrolo[3,4-c]isoquinolin-5-one |
|---|---|
| PubChem CID | 11716185 |
| Molecular Formula | C13H15ClN2O |
| Molecular Weight | 250.73 g/mol |
| Exact Mass | 250.09 |
| IUPAC Name | (3aR,9bS)-6-chloro-8-ethyl-1,2,3,3a,4,9b-hexahydropyrrolo[3,4-c]isoquinolin-5-one |
| SMILES | CCc1cc(Cl)c2c(c1)[C@H]1CNC[C@@H]1NC2=O |
| InChI | InChI=1S/C13H15ClN2O/c1-2-7-3-8-9-5-15-6-11(9)16-13(17)12(8)10(14)4-7/h3-4,9,11,15H,2,5-6H2,1H3,(H,16,17)/t9-,11+/m1/s1 |
| InChIKey | OJWLDYFNCCLCET-KOLCDFICSA-N |
| XLogP | 1.70 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.73 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |