About 5-O-ethyl 1-O-methyl (2S,3S)-2-ethyl-3-hydroxy-3-phenylpentanedioate
5-O-ethyl 1-O-methyl (2S,3S)-2-ethyl-3-hydroxy-3-phenylpentanedioate (PubChem CID 11716297) has the molecular formula C16H22O5
and a molecular weight of 294.35 g/mol. Its IUPAC name is 5-O-ethyl 1-O-methyl (2S,3S)-2-ethyl-3-hydroxy-3-phenylpentanedioate.
Analyze 5-O-ethyl 1-O-methyl (2S,3S)-2-ethyl-3-hydroxy-3-phenylpentanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-O-ethyl 1-O-methyl (2S,3S)-2-ethyl-3-hydroxy-3-phenylpentanedioate?
The IUPAC name of 5-O-ethyl 1-O-methyl (2S,3S)-2-ethyl-3-hydroxy-3-phenylpentanedioate (CID 11716297) is 5-O-ethyl 1-O-methyl (2S,3S)-2-ethyl-3-hydroxy-3-phenylpentanedioate.
What is the SMILES notation for 5-O-ethyl 1-O-methyl (2S,3S)-2-ethyl-3-hydroxy-3-phenylpentanedioate?
The canonical SMILES for 5-O-ethyl 1-O-methyl (2S,3S)-2-ethyl-3-hydroxy-3-phenylpentanedioate is CCOC(=O)C[C@@](O)(c1ccccc1)[C@H](CC)C(=O)OC.
What is the InChIKey of 5-O-ethyl 1-O-methyl (2S,3S)-2-ethyl-3-hydroxy-3-phenylpentanedioate?
The InChIKey is WTMKCOYHDVOCCE-CZUORRHYSA-N. The full InChI is InChI=1S/C16H22O5/c1-4-13(15(18)20-3)16(19,11-14(17)21-5-2)12-9-7-6-8-10-12/h6-10,13,19H,4-5,11H2,1-3H3/t13-,16-/m1/s1.
What are the key properties of 5-O-ethyl 1-O-methyl (2S,3S)-2-ethyl-3-hydroxy-3-phenylpentanedioate?
5-O-ethyl 1-O-methyl (2S,3S)-2-ethyl-3-hydroxy-3-phenylpentanedioate has a molecular weight of 294.35 g/mol, XLogP of 2.03, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-O-ethyl 1-O-methyl (2S,3S)-2-ethyl-3-hydroxy-3-phenylpentanedioate is sourced from PubChem (CID 11716297), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).