C16H22N4O — CID 117163310
3-(oxan-2-yl)-2-(pyrrolidin-2-ylmethyl)imidazo[4,5-b]pyridine (PubChem CID 117163310) has the molecular formula C16H22N4O and a molecular weight of 286.38 g/mol. Its IUPAC name is 3-(oxan-2-yl)-2-(pyrrolidin-2-ylmethyl)imidazo[4,5-b]pyridine.
| Compound Name | 3-(oxan-2-yl)-2-(pyrrolidin-2-ylmethyl)imidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 117163310 |
| Molecular Formula | C16H22N4O |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.18 |
| IUPAC Name | 3-(oxan-2-yl)-2-(pyrrolidin-2-ylmethyl)imidazo[4,5-b]pyridine |
| SMILES | c1cnc2c(c1)nc(CC1CCCN1)n2C1CCCCO1 |
| InChI | InChI=1S/C16H22N4O/c1-2-10-21-15(7-1)20-14(11-12-5-3-8-17-12)19-13-6-4-9-18-16(13)20/h4,6,9,12,15,17H,1-3,5,7-8,10-11H2 |
| InChIKey | PMNQMGLNGAYWJU-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |